C18H19Cl2NO4S — CID 7567916
(4-chlorophenyl)methyl (2S)-2-[(4-chlorophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 7567916) has the molecular formula C18H19Cl2NO4S and a molecular weight of 416.33 g/mol. Its IUPAC name is (4-chlorophenyl)methyl (2S)-2-[(4-chlorophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | (4-chlorophenyl)methyl (2S)-2-[(4-chlorophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7567916 |
| Molecular Formula | C18H19Cl2NO4S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | (4-chlorophenyl)methyl (2S)-2-[(4-chlorophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc(Cl)cc1)C(=O)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2NO4S/c1-12(2)17(18(22)25-11-13-3-5-14(19)6-4-13)21-26(23,24)16-9-7-15(20)8-10-16/h3-10,12,17,21H,11H2,1-2H3/t17-/m0/s1 |
| InChIKey | ILJIBNSGYWRBNX-KRWDZBQOSA-N |
| XLogP | 4.04 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |