C18H19BrFNO4S — CID 16565660
(3-fluorophenyl)methyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 16565660) has the molecular formula C18H19BrFNO4S and a molecular weight of 444.32 g/mol. Its IUPAC name is (3-fluorophenyl)methyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | (3-fluorophenyl)methyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 16565660 |
| Molecular Formula | C18H19BrFNO4S |
| Molecular Weight | 444.32 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | (3-fluorophenyl)methyl (2S)-2-[(4-bromophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc(Br)cc1)C(=O)OCc1cccc(F)c1 |
| InChI | InChI=1S/C18H19BrFNO4S/c1-12(2)17(18(22)25-11-13-4-3-5-15(20)10-13)21-26(23,24)16-8-6-14(19)7-9-16/h3-10,12,17,21H,11H2,1-2H3/t17-/m0/s1 |
| InChIKey | IIODHENIWJJKSB-KRWDZBQOSA-N |
| XLogP | 3.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |