C18H21NO5S — CID 22215096
benzyl (2S)-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]butanoate (PubChem CID 22215096) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is benzyl (2S)-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]butanoate.
| Compound Name | benzyl (2S)-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 22215096 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | benzyl (2S)-3-hydroxy-2-[(4-methylphenyl)sulfonylamino]butanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](C(=O)OCc2ccccc2)C(C)O)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-13-8-10-16(11-9-13)25(22,23)19-17(14(2)20)18(21)24-12-15-6-4-3-5-7-15/h3-11,14,17,19-20H,12H2,1-2H3/t14?,17-/m0/s1 |
| InChIKey | ARTBRWILFUIMST-JRZJBTRGSA-N |
| XLogP | 1.77 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |