C20H23ClN2O8S2 — CID 2483575
dimethyl 5-amino-3-[[(2S)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoyl]oxymethyl]thiophene-2,4-dicarboxylate (PubChem CID 2483575) has the molecular formula C20H23ClN2O8S2 and a molecular weight of 519.00 g/mol. Its IUPAC name is dimethyl 5-amino-3-[[(2S)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoyl]oxymethyl]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-amino-3-[[(2S)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoyl]oxymethyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2483575 |
| Molecular Formula | C20H23ClN2O8S2 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | dimethyl 5-amino-3-[[(2S)-2-[(3-chlorophenyl)sulfonylamino]-3-methylbutanoyl]oxymethyl]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(N)c(C(=O)OC)c1COC(=O)[C@@H](NS(=O)(=O)c1cccc(Cl)c1)C(C)C |
| InChI | InChI=1S/C20H23ClN2O8S2/c1-10(2)15(23-33(27,28)12-7-5-6-11(21)8-12)19(25)31-9-13-14(18(24)29-3)17(22)32-16(13)20(26)30-4/h5-8,10,15,23H,9,22H2,1-4H3/t15-/m0/s1 |
| InChIKey | GDOWHCPQXOYTPC-HNNXBMFYSA-N |
| XLogP | 2.60 |
| TPSA | 151.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|