C19H22N2O8S — CID 51581817
dimethyl 5-amino-3-[[(2S)-2-(furan-2-carbonylamino)-3-methylbutanoyl]oxymethyl]thiophene-2,4-dicarboxylate (PubChem CID 51581817) has the molecular formula C19H22N2O8S and a molecular weight of 438.46 g/mol. Its IUPAC name is dimethyl 5-amino-3-[[(2S)-2-(furan-2-carbonylamino)-3-methylbutanoyl]oxymethyl]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-amino-3-[[(2S)-2-(furan-2-carbonylamino)-3-methylbutanoyl]oxymethyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 51581817 |
| Molecular Formula | C19H22N2O8S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | dimethyl 5-amino-3-[[(2S)-2-(furan-2-carbonylamino)-3-methylbutanoyl]oxymethyl]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(N)c(C(=O)OC)c1COC(=O)[C@@H](NC(=O)c1ccco1)C(C)C |
| InChI | InChI=1S/C19H22N2O8S/c1-9(2)13(21-16(22)11-6-5-7-28-11)18(24)29-8-10-12(17(23)26-3)15(20)30-14(10)19(25)27-4/h5-7,9,13H,8,20H2,1-4H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | XOICENOIGZTADU-ZDUSSCGKSA-N |
| XLogP | 1.99 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|