C17H25NO4 — CID 51491143
cyclohexylmethyl (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate (PubChem CID 51491143) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is cyclohexylmethyl (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate.
| Compound Name | cyclohexylmethyl (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 51491143 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | cyclohexylmethyl (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccco1)C(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C17H25NO4/c1-12(2)15(18-16(19)14-9-6-10-21-14)17(20)22-11-13-7-4-3-5-8-13/h6,9-10,12-13,15H,3-5,7-8,11H2,1-2H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | IEUMMPXIGXGGPY-HNNXBMFYSA-N |
| XLogP | 3.16 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |