C14H12BrNO7S — CID 18777113
dimethyl 5-amino-3-[(5-bromofuran-2-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate (PubChem CID 18777113) has the molecular formula C14H12BrNO7S and a molecular weight of 418.22 g/mol. Its IUPAC name is dimethyl 5-amino-3-[(5-bromofuran-2-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-amino-3-[(5-bromofuran-2-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 18777113 |
| Molecular Formula | C14H12BrNO7S |
| Molecular Weight | 418.22 g/mol |
| Exact Mass | 416.95 |
| IUPAC Name | dimethyl 5-amino-3-[(5-bromofuran-2-carbonyl)oxymethyl]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(N)c(C(=O)OC)c1COC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C14H12BrNO7S/c1-20-13(18)9-6(10(14(19)21-2)24-11(9)16)5-22-12(17)7-3-4-8(15)23-7/h3-4H,5,16H2,1-2H3 |
| InChIKey | ZXKQJLIUABZRGI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|