C18H19NO8S — CID 7846626
dimethyl 5-amino-3-[[2-(4-methoxyphenoxy)acetyl]oxymethyl]thiophene-2,4-dicarboxylate (PubChem CID 7846626) has the molecular formula C18H19NO8S and a molecular weight of 409.42 g/mol. Its IUPAC name is dimethyl 5-amino-3-[[2-(4-methoxyphenoxy)acetyl]oxymethyl]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-amino-3-[[2-(4-methoxyphenoxy)acetyl]oxymethyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7846626 |
| Molecular Formula | C18H19NO8S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | dimethyl 5-amino-3-[[2-(4-methoxyphenoxy)acetyl]oxymethyl]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(N)c(C(=O)OC)c1COC(=O)COc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H19NO8S/c1-23-10-4-6-11(7-5-10)26-9-13(20)27-8-12-14(17(21)24-2)16(19)28-15(12)18(22)25-3/h4-7H,8-9,19H2,1-3H3 |
| InChIKey | QYYSUYXVSTUTHA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|