C17H15ClN2O5S — CID 8579465
ethyl 5-amino-3-[[2-(4-chlorophenoxy)acetyl]oxymethyl]-4-cyanothiophene-2-carboxylate (PubChem CID 8579465) has the molecular formula C17H15ClN2O5S and a molecular weight of 394.84 g/mol. Its IUPAC name is ethyl 5-amino-3-[[2-(4-chlorophenoxy)acetyl]oxymethyl]-4-cyanothiophene-2-carboxylate.
| Compound Name | ethyl 5-amino-3-[[2-(4-chlorophenoxy)acetyl]oxymethyl]-4-cyanothiophene-2-carboxylate |
|---|---|
| PubChem CID | 8579465 |
| Molecular Formula | C17H15ClN2O5S |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | ethyl 5-amino-3-[[2-(4-chlorophenoxy)acetyl]oxymethyl]-4-cyanothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C#N)c1COC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClN2O5S/c1-2-23-17(22)15-13(12(7-19)16(20)26-15)8-25-14(21)9-24-11-5-3-10(18)4-6-11/h3-6H,2,8-9,20H2,1H3 |
| InChIKey | XWRMUCGMCHSWGB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |