C18H16N2O4S — CID 7853030
ethyl 5-amino-4-cyano-3-[[(E)-3-phenylprop-2-enoyl]oxymethyl]thiophene-2-carboxylate (PubChem CID 7853030) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is ethyl 5-amino-4-cyano-3-[[(E)-3-phenylprop-2-enoyl]oxymethyl]thiophene-2-carboxylate.
| Compound Name | ethyl 5-amino-4-cyano-3-[[(E)-3-phenylprop-2-enoyl]oxymethyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 7853030 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | ethyl 5-amino-4-cyano-3-[[(E)-3-phenylprop-2-enoyl]oxymethyl]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C#N)c1COC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H16N2O4S/c1-2-23-18(22)16-14(13(10-19)17(20)25-16)11-24-15(21)9-8-12-6-4-3-5-7-12/h3-9H,2,11,20H2,1H3/b9-8+ |
| InChIKey | WCJPZHBVHVQZSO-CMDGGOBGSA-N |
| XLogP | 3.14 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|