C20H19N3O5S — CID 7229364
ethyl 3-[[(Z)-2-acetamido-3-phenylprop-2-enoyl]oxymethyl]-5-amino-4-cyanothiophene-2-carboxylate (PubChem CID 7229364) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is ethyl 3-[[(Z)-2-acetamido-3-phenylprop-2-enoyl]oxymethyl]-5-amino-4-cyanothiophene-2-carboxylate.
| Compound Name | ethyl 3-[[(Z)-2-acetamido-3-phenylprop-2-enoyl]oxymethyl]-5-amino-4-cyanothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7229364 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | ethyl 3-[[(Z)-2-acetamido-3-phenylprop-2-enoyl]oxymethyl]-5-amino-4-cyanothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C#N)c1COC(=O)/C(=C/c1ccccc1)NC(C)=O |
| InChI | InChI=1S/C20H19N3O5S/c1-3-27-20(26)17-15(14(10-21)18(22)29-17)11-28-19(25)16(23-12(2)24)9-13-7-5-4-6-8-13/h4-9H,3,11,22H2,1-2H3,(H,23,24)/b16-9- |
| InChIKey | RLSZMMIHGUNLGY-SXGWCWSVSA-N |
| XLogP | 2.60 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|