C18H14N4O5S — CID 7541449
(5-amino-4-cyano-2-ethoxycarbonylthiophen-3-yl)methyl 4-oxo-3H-phthalazine-1-carboxylate (PubChem CID 7541449) has the molecular formula C18H14N4O5S and a molecular weight of 398.40 g/mol. Its IUPAC name is (5-amino-4-cyano-2-ethoxycarbonylthiophen-3-yl)methyl 4-oxo-3H-phthalazine-1-carboxylate.
| Compound Name | (5-amino-4-cyano-2-ethoxycarbonylthiophen-3-yl)methyl 4-oxo-3H-phthalazine-1-carboxylate |
|---|---|
| PubChem CID | 7541449 |
| Molecular Formula | C18H14N4O5S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | (5-amino-4-cyano-2-ethoxycarbonylthiophen-3-yl)methyl 4-oxo-3H-phthalazine-1-carboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C#N)c1COC(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C18H14N4O5S/c1-2-26-18(25)14-12(11(7-19)15(20)28-14)8-27-17(24)13-9-5-3-4-6-10(9)16(23)22-21-13/h3-6H,2,8,20H2,1H3,(H,22,23) |
| InChIKey | WAXQQYCPDDBWIT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 148.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |