C14H11N3O6S2 — CID 2112443
ethyl 5-amino-4-cyano-3-[(5-nitrothiophene-2-carbonyl)oxymethyl]thiophene-2-carboxylate (PubChem CID 2112443) has the molecular formula C14H11N3O6S2 and a molecular weight of 381.39 g/mol. Its IUPAC name is ethyl 5-amino-4-cyano-3-[(5-nitrothiophene-2-carbonyl)oxymethyl]thiophene-2-carboxylate.
| Compound Name | ethyl 5-amino-4-cyano-3-[(5-nitrothiophene-2-carbonyl)oxymethyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2112443 |
| Molecular Formula | C14H11N3O6S2 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | ethyl 5-amino-4-cyano-3-[(5-nitrothiophene-2-carbonyl)oxymethyl]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C#N)c1COC(=O)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C14H11N3O6S2/c1-2-22-14(19)11-8(7(5-15)12(16)25-11)6-23-13(18)9-3-4-10(24-9)17(20)21/h3-4H,2,6,16H2,1H3 |
| InChIKey | HOMPKFMZKJSONM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|