C16H15N3O6S — CID 38897642
ethyl 5-amino-4-cyano-3-[(2-methoxy-5-nitrophenoxy)methyl]thiophene-2-carboxylate (PubChem CID 38897642) has the molecular formula C16H15N3O6S and a molecular weight of 377.38 g/mol. Its IUPAC name is ethyl 5-amino-4-cyano-3-[(2-methoxy-5-nitrophenoxy)methyl]thiophene-2-carboxylate.
| Compound Name | ethyl 5-amino-4-cyano-3-[(2-methoxy-5-nitrophenoxy)methyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 38897642 |
| Molecular Formula | C16H15N3O6S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | ethyl 5-amino-4-cyano-3-[(2-methoxy-5-nitrophenoxy)methyl]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C#N)c1COc1cc([N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C16H15N3O6S/c1-3-24-16(20)14-11(10(7-17)15(18)26-14)8-25-13-6-9(19(21)22)4-5-12(13)23-2/h4-6H,3,8,18H2,1-2H3 |
| InChIKey | YRNNVNTYTNPUCP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|