C15H13ClN2O7S — CID 7865847
dimethyl 5-amino-3-[(2-chloro-4-nitrophenoxy)methyl]thiophene-2,4-dicarboxylate (PubChem CID 7865847) has the molecular formula C15H13ClN2O7S and a molecular weight of 400.80 g/mol. Its IUPAC name is dimethyl 5-amino-3-[(2-chloro-4-nitrophenoxy)methyl]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-amino-3-[(2-chloro-4-nitrophenoxy)methyl]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7865847 |
| Molecular Formula | C15H13ClN2O7S |
| Molecular Weight | 400.80 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | dimethyl 5-amino-3-[(2-chloro-4-nitrophenoxy)methyl]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(N)c(C(=O)OC)c1COc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H13ClN2O7S/c1-23-14(19)11-8(12(15(20)24-2)26-13(11)17)6-25-10-4-3-7(18(21)22)5-9(10)16/h3-5H,6,17H2,1-2H3 |
| InChIKey | OKXARXRIXOEYAZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.80 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|