C23H21ClN2O9S — CID 19461823
2-O-methyl 4-O-propyl 5-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19461823) has the molecular formula C23H21ClN2O9S and a molecular weight of 536.95 g/mol. Its IUPAC name is 2-O-methyl 4-O-propyl 5-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | 2-O-methyl 4-O-propyl 5-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19461823 |
| Molecular Formula | C23H21ClN2O9S |
| Molecular Weight | 536.95 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | 2-O-methyl 4-O-propyl 5-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)c2ccc(COc3ccc([N+](=O)[O-])cc3Cl)o2)sc(C(=O)OC)c1C |
| InChI | InChI=1S/C23H21ClN2O9S/c1-4-9-33-22(28)18-12(2)19(23(29)32-3)36-21(18)25-20(27)17-8-6-14(35-17)11-34-16-7-5-13(26(30)31)10-15(16)24/h5-8,10H,4,9,11H2,1-3H3,(H,25,27) |
| InChIKey | UIDMXCPGQCLETK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.95 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|