C22H20ClN3O8S — CID 19461825
propan-2-yl 5-carbamoyl-2-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4-methylthiophene-3-carboxylate (PubChem CID 19461825) has the molecular formula C22H20ClN3O8S and a molecular weight of 521.94 g/mol. Its IUPAC name is propan-2-yl 5-carbamoyl-2-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4-methylthiophene-3-carboxylate.
| Compound Name | propan-2-yl 5-carbamoyl-2-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19461825 |
| Molecular Formula | C22H20ClN3O8S |
| Molecular Weight | 521.94 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | propan-2-yl 5-carbamoyl-2-[[5-[(2-chloro-4-nitrophenoxy)methyl]furan-2-carbonyl]amino]-4-methylthiophene-3-carboxylate |
| SMILES | Cc1c(C(N)=O)sc(NC(=O)c2ccc(COc3ccc([N+](=O)[O-])cc3Cl)o2)c1C(=O)OC(C)C |
| InChI | InChI=1S/C22H20ClN3O8S/c1-10(2)33-22(29)17-11(3)18(19(24)27)35-21(17)25-20(28)16-7-5-13(34-16)9-32-15-6-4-12(26(30)31)8-14(15)23/h4-8,10H,9H2,1-3H3,(H2,24,27)(H,25,28) |
| InChIKey | XEYPKSCNCSPBCS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 164.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.94 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|