C24H20F5NO7S — CID 19461374
2-O-ethyl 4-O-propan-2-yl 3-methyl-5-[[5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carbonyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 19461374) has the molecular formula C24H20F5NO7S and a molecular weight of 561.48 g/mol. Its IUPAC name is 2-O-ethyl 4-O-propan-2-yl 3-methyl-5-[[5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carbonyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | 2-O-ethyl 4-O-propan-2-yl 3-methyl-5-[[5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carbonyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19461374 |
| Molecular Formula | C24H20F5NO7S |
| Molecular Weight | 561.48 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | 2-O-ethyl 4-O-propan-2-yl 3-methyl-5-[[5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carbonyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2ccc(COc3c(F)c(F)c(F)c(F)c3F)o2)c(C(=O)OC(C)C)c1C |
| InChI | InChI=1S/C24H20F5NO7S/c1-5-34-24(33)20-10(4)13(23(32)36-9(2)3)22(38-20)30-21(31)12-7-6-11(37-12)8-35-19-17(28)15(26)14(25)16(27)18(19)29/h6-7,9H,5,8H2,1-4H3,(H,30,31) |
| InChIKey | BBQBKQQJJZNHMN-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|