C25H22F5NO5S — CID 19461407
butan-2-yl 2-[[5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19461407) has the molecular formula C25H22F5NO5S and a molecular weight of 543.51 g/mol. Its IUPAC name is butan-2-yl 2-[[5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | butan-2-yl 2-[[5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19461407 |
| Molecular Formula | C25H22F5NO5S |
| Molecular Weight | 543.51 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | butan-2-yl 2-[[5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCC(C)OC(=O)c1c(NC(=O)c2ccc(COc3c(F)c(F)c(F)c(F)c3F)o2)sc2c1CCCC2 |
| InChI | InChI=1S/C25H22F5NO5S/c1-3-11(2)35-25(33)16-13-6-4-5-7-15(13)37-24(16)31-23(32)14-9-8-12(36-14)10-34-22-20(29)18(27)17(26)19(28)21(22)30/h8-9,11H,3-7,10H2,1-2H3,(H,31,32) |
| InChIKey | SMFPBHPRLWQCAN-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.51 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|