C27H22ClN3O8 — CID 169388292
dimethyl 3-[3-[(2-chloro-4-nitrophenoxy)methyl]-4-methoxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169388292) has the molecular formula C27H22ClN3O8 and a molecular weight of 551.94 g/mol. Its IUPAC name is dimethyl 3-[3-[(2-chloro-4-nitrophenoxy)methyl]-4-methoxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[3-[(2-chloro-4-nitrophenoxy)methyl]-4-methoxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169388292 |
| Molecular Formula | C27H22ClN3O8 |
| Molecular Weight | 551.94 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | dimethyl 3-[3-[(2-chloro-4-nitrophenoxy)methyl]-4-methoxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2ccc(OC)c(COc3ccc([N+](=O)[O-])cc3Cl)c2)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C27H22ClN3O8/c1-36-21-11-9-16(13-17(21)15-39-22-12-10-19(31(34)35)14-20(22)28)24-23(26(32)37-2)25(27(33)38-3)30(29-24)18-7-5-4-6-8-18/h4-14H,15H2,1-3H3 |
| InChIKey | PRVQOXATDCGPQF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 132.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.94 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|