C28H25N3O8 — CID 169388317
dimethyl 3-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169388317) has the molecular formula C28H25N3O8 and a molecular weight of 531.52 g/mol. Its IUPAC name is dimethyl 3-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169388317 |
| Molecular Formula | C28H25N3O8 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | dimethyl 3-[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2ccc(OC)c(COc3ccc([N+](=O)[O-])c(C)c3)c2)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C28H25N3O8/c1-17-14-21(11-12-22(17)31(34)35)39-16-19-15-18(10-13-23(19)36-2)25-24(27(32)37-3)26(28(33)38-4)30(29-25)20-8-6-5-7-9-20/h5-15H,16H2,1-4H3 |
| InChIKey | SROKRQRYEKJBQC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 132.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|