C21H19N3O8 — CID 169387640
dimethyl 3-(3,4-dimethoxy-5-nitrophenyl)-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169387640) has the molecular formula C21H19N3O8 and a molecular weight of 441.40 g/mol. Its IUPAC name is dimethyl 3-(3,4-dimethoxy-5-nitrophenyl)-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(3,4-dimethoxy-5-nitrophenyl)-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169387640 |
| Molecular Formula | C21H19N3O8 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | dimethyl 3-(3,4-dimethoxy-5-nitrophenyl)-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2cc(OC)c(OC)c([N+](=O)[O-])c2)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C21H19N3O8/c1-29-15-11-12(10-14(24(27)28)19(15)30-2)17-16(20(25)31-3)18(21(26)32-4)23(22-17)13-8-6-5-7-9-13/h5-11H,1-4H3 |
| InChIKey | DJFCWEHZHXUJMP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 132.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|