C21H19N3O7 — CID 169388215
dimethyl 3-(5-ethyl-2-hydroxy-3-nitrophenyl)-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169388215) has the molecular formula C21H19N3O7 and a molecular weight of 425.40 g/mol. Its IUPAC name is dimethyl 3-(5-ethyl-2-hydroxy-3-nitrophenyl)-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(5-ethyl-2-hydroxy-3-nitrophenyl)-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169388215 |
| Molecular Formula | C21H19N3O7 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | dimethyl 3-(5-ethyl-2-hydroxy-3-nitrophenyl)-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | CCc1cc(-c2nn(-c3ccccc3)c(C(=O)OC)c2C(=O)OC)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H19N3O7/c1-4-12-10-14(19(25)15(11-12)24(28)29)17-16(20(26)30-2)18(21(27)31-3)23(22-17)13-8-6-5-7-9-13/h5-11,25H,4H2,1-3H3 |
| InChIKey | RULMBKVLNQEOQX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|