C22H19N3O10 — CID 169388800
2-[2-[4,5-bis(methoxycarbonyl)-1-phenylpyrazol-3-yl]-6-methoxy-4-nitrophenoxy]acetic acid (PubChem CID 169388800) has the molecular formula C22H19N3O10 and a molecular weight of 485.41 g/mol. Its IUPAC name is 2-[2-[4,5-bis(methoxycarbonyl)-1-phenylpyrazol-3-yl]-6-methoxy-4-nitrophenoxy]acetic acid.
| Compound Name | 2-[2-[4,5-bis(methoxycarbonyl)-1-phenylpyrazol-3-yl]-6-methoxy-4-nitrophenoxy]acetic acid |
|---|---|
| PubChem CID | 169388800 |
| Molecular Formula | C22H19N3O10 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 2-[2-[4,5-bis(methoxycarbonyl)-1-phenylpyrazol-3-yl]-6-methoxy-4-nitrophenoxy]acetic acid |
| SMILES | COC(=O)c1c(-c2cc([N+](=O)[O-])cc(OC)c2OCC(=O)O)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C22H19N3O10/c1-32-15-10-13(25(30)31)9-14(20(15)35-11-16(26)27)18-17(21(28)33-2)19(22(29)34-3)24(23-18)12-7-5-4-6-8-12/h4-10H,11H2,1-3H3,(H,26,27) |
| InChIKey | QSQVVUGPRGVJRH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 169.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|