C23H22N2O5 — CID 169387677
dimethyl 3-[2-(2-methylprop-2-enoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169387677) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is dimethyl 3-[2-(2-methylprop-2-enoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[2-(2-methylprop-2-enoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169387677 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | dimethyl 3-[2-(2-methylprop-2-enoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | C=C(C)COc1ccccc1-c1nn(-c2ccccc2)c(C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C23H22N2O5/c1-15(2)14-30-18-13-9-8-12-17(18)20-19(22(26)28-3)21(23(27)29-4)25(24-20)16-10-6-5-7-11-16/h5-13H,1,14H2,2-4H3 |
| InChIKey | JIWOUQGOVNCPDZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|