C23H21N3O10 — CID 169389167
dimethyl 3-[5-methoxy-4-(2-methoxy-2-oxoethoxy)-2-nitrophenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169389167) has the molecular formula C23H21N3O10 and a molecular weight of 499.43 g/mol. Its IUPAC name is dimethyl 3-[5-methoxy-4-(2-methoxy-2-oxoethoxy)-2-nitrophenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[5-methoxy-4-(2-methoxy-2-oxoethoxy)-2-nitrophenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169389167 |
| Molecular Formula | C23H21N3O10 |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | dimethyl 3-[5-methoxy-4-(2-methoxy-2-oxoethoxy)-2-nitrophenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)COc1cc([N+](=O)[O-])c(-c2nn(-c3ccccc3)c(C(=O)OC)c2C(=O)OC)cc1OC |
| InChI | InChI=1S/C23H21N3O10/c1-32-16-10-14(15(26(30)31)11-17(16)36-12-18(27)33-2)20-19(22(28)34-3)21(23(29)35-4)25(24-20)13-8-6-5-7-9-13/h5-11H,12H2,1-4H3 |
| InChIKey | TVKBVTQSYVFINS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 158.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|