C20H14F3N3O7 — CID 169389759
dimethyl 3-[5-nitro-2-(trifluoromethoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169389759) has the molecular formula C20H14F3N3O7 and a molecular weight of 465.34 g/mol. Its IUPAC name is dimethyl 3-[5-nitro-2-(trifluoromethoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[5-nitro-2-(trifluoromethoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169389759 |
| Molecular Formula | C20H14F3N3O7 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | dimethyl 3-[5-nitro-2-(trifluoromethoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2cc([N+](=O)[O-])ccc2OC(F)(F)F)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C20H14F3N3O7/c1-31-18(27)15-16(13-10-12(26(29)30)8-9-14(13)33-20(21,22)23)24-25(17(15)19(28)32-2)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | URJRRSSAFXNKFQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 122.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|