C20H16FN3O6 — CID 169389708
dimethyl 3-(2-fluoro-4-methyl-6-nitrophenyl)-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169389708) has the molecular formula C20H16FN3O6 and a molecular weight of 413.36 g/mol. Its IUPAC name is dimethyl 3-(2-fluoro-4-methyl-6-nitrophenyl)-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(2-fluoro-4-methyl-6-nitrophenyl)-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169389708 |
| Molecular Formula | C20H16FN3O6 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | dimethyl 3-(2-fluoro-4-methyl-6-nitrophenyl)-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2c(F)cc(C)cc2[N+](=O)[O-])nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C20H16FN3O6/c1-11-9-13(21)15(14(10-11)24(27)28)17-16(19(25)29-2)18(20(26)30-3)23(22-17)12-7-5-4-6-8-12/h4-10H,1-3H3 |
| InChIKey | RICBAFMIFXTOAS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 113.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|