C27H20N2O4 — CID 169387301
dimethyl 3-anthracen-9-yl-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169387301) has the molecular formula C27H20N2O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is dimethyl 3-anthracen-9-yl-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-anthracen-9-yl-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169387301 |
| Molecular Formula | C27H20N2O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | dimethyl 3-anthracen-9-yl-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2c3ccccc3cc3ccccc23)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C27H20N2O4/c1-32-26(30)23-24(28-29(25(23)27(31)33-2)19-12-4-3-5-13-19)22-20-14-8-6-10-17(20)16-18-11-7-9-15-21(18)22/h3-16H,1-2H3 |
| InChIKey | KSMZTKMNEAZVBD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|