C20H15F3N2O5 — CID 169390229
dimethyl 1-phenyl-3-(2,3,4-trifluoro-6-methoxyphenyl)pyrazole-4,5-dicarboxylate (PubChem CID 169390229) has the molecular formula C20H15F3N2O5 and a molecular weight of 420.34 g/mol. Its IUPAC name is dimethyl 1-phenyl-3-(2,3,4-trifluoro-6-methoxyphenyl)pyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 1-phenyl-3-(2,3,4-trifluoro-6-methoxyphenyl)pyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169390229 |
| Molecular Formula | C20H15F3N2O5 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | dimethyl 1-phenyl-3-(2,3,4-trifluoro-6-methoxyphenyl)pyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2c(OC)cc(F)c(F)c2F)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C20H15F3N2O5/c1-28-12-9-11(21)15(22)16(23)13(12)17-14(19(26)29-2)18(20(27)30-3)25(24-17)10-7-5-4-6-8-10/h4-9H,1-3H3 |
| InChIKey | UFNAJYHCHPRDFR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|