C19H12BrF3N2O4 — CID 169389726
dimethyl 3-(3-bromo-2,5,6-trifluorophenyl)-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169389726) has the molecular formula C19H12BrF3N2O4 and a molecular weight of 469.21 g/mol. Its IUPAC name is dimethyl 3-(3-bromo-2,5,6-trifluorophenyl)-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(3-bromo-2,5,6-trifluorophenyl)-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169389726 |
| Molecular Formula | C19H12BrF3N2O4 |
| Molecular Weight | 469.21 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | dimethyl 3-(3-bromo-2,5,6-trifluorophenyl)-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2c(F)c(F)cc(Br)c2F)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C19H12BrF3N2O4/c1-28-18(26)13-16(12-14(22)10(20)8-11(21)15(12)23)24-25(17(13)19(27)29-2)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | GYASLVDIXHVARG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.21 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|