C20H16BrFN2O4 — CID 169390088
dimethyl 3-[5-(bromomethyl)-2-fluorophenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169390088) has the molecular formula C20H16BrFN2O4 and a molecular weight of 447.26 g/mol. Its IUPAC name is dimethyl 3-[5-(bromomethyl)-2-fluorophenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[5-(bromomethyl)-2-fluorophenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169390088 |
| Molecular Formula | C20H16BrFN2O4 |
| Molecular Weight | 447.26 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | dimethyl 3-[5-(bromomethyl)-2-fluorophenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2cc(CBr)ccc2F)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C20H16BrFN2O4/c1-27-19(25)16-17(14-10-12(11-21)8-9-15(14)22)23-24(18(16)20(26)28-2)13-6-4-3-5-7-13/h3-10H,11H2,1-2H3 |
| InChIKey | KHXURWJLHNJGJA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.26 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|