C19H16BFN2O6 — CID 169387582
[2-[4,5-bis(methoxycarbonyl)-1-phenylpyrazol-3-yl]-4-fluorophenyl]boronic acid (PubChem CID 169387582) has the molecular formula C19H16BFN2O6 and a molecular weight of 398.16 g/mol. Its IUPAC name is [2-[4,5-bis(methoxycarbonyl)-1-phenylpyrazol-3-yl]-4-fluorophenyl]boronic acid.
| Compound Name | [2-[4,5-bis(methoxycarbonyl)-1-phenylpyrazol-3-yl]-4-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 169387582 |
| Molecular Formula | C19H16BFN2O6 |
| Molecular Weight | 398.16 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | [2-[4,5-bis(methoxycarbonyl)-1-phenylpyrazol-3-yl]-4-fluorophenyl]boronic acid |
| SMILES | COC(=O)c1c(-c2cc(F)ccc2B(O)O)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C19H16BFN2O6/c1-28-18(24)15-16(13-10-11(21)8-9-14(13)20(26)27)22-23(17(15)19(25)29-2)12-6-4-3-5-7-12/h3-10,26-27H,1-2H3 |
| InChIKey | YDFUOTVEJJJIDM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.16 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|