C25H17BrN4O9 — CID 169389400
dimethyl 3-[5-bromo-2-(2,4-dinitrophenoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169389400) has the molecular formula C25H17BrN4O9 and a molecular weight of 597.33 g/mol. Its IUPAC name is dimethyl 3-[5-bromo-2-(2,4-dinitrophenoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[5-bromo-2-(2,4-dinitrophenoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169389400 |
| Molecular Formula | C25H17BrN4O9 |
| Molecular Weight | 597.33 g/mol |
| Exact Mass | 596.02 |
| IUPAC Name | dimethyl 3-[5-bromo-2-(2,4-dinitrophenoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2cc(Br)ccc2Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C25H17BrN4O9/c1-37-24(31)21-22(27-28(23(21)25(32)38-2)15-6-4-3-5-7-15)17-12-14(26)8-10-19(17)39-20-11-9-16(29(33)34)13-18(20)30(35)36/h3-13H,1-2H3 |
| InChIKey | ZOABVNYIRRNGJF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 165.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.33 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|