C25H25BrN2O7 — CID 169389228
dimethyl 3-[5-bromo-2-(4-ethoxy-4-oxobutoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169389228) has the molecular formula C25H25BrN2O7 and a molecular weight of 545.39 g/mol. Its IUPAC name is dimethyl 3-[5-bromo-2-(4-ethoxy-4-oxobutoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[5-bromo-2-(4-ethoxy-4-oxobutoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169389228 |
| Molecular Formula | C25H25BrN2O7 |
| Molecular Weight | 545.39 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | dimethyl 3-[5-bromo-2-(4-ethoxy-4-oxobutoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)CCCOc1ccc(Br)cc1-c1nn(-c2ccccc2)c(C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C25H25BrN2O7/c1-4-34-20(29)11-8-14-35-19-13-12-16(26)15-18(19)22-21(24(30)32-2)23(25(31)33-3)28(27-22)17-9-6-5-7-10-17/h5-7,9-10,12-13,15H,4,8,11,14H2,1-3H3 |
| InChIKey | GBDVQJXHDNLJPQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 105.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|