C23H22BrIN2O5 — CID 169389391
dimethyl 3-(5-bromo-2-butoxy-3-iodophenyl)-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169389391) has the molecular formula C23H22BrIN2O5 and a molecular weight of 613.25 g/mol. Its IUPAC name is dimethyl 3-(5-bromo-2-butoxy-3-iodophenyl)-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(5-bromo-2-butoxy-3-iodophenyl)-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169389391 |
| Molecular Formula | C23H22BrIN2O5 |
| Molecular Weight | 613.25 g/mol |
| Exact Mass | 611.98 |
| IUPAC Name | dimethyl 3-(5-bromo-2-butoxy-3-iodophenyl)-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | CCCCOc1c(I)cc(Br)cc1-c1nn(-c2ccccc2)c(C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C23H22BrIN2O5/c1-4-5-11-32-21-16(12-14(24)13-17(21)25)19-18(22(28)30-2)20(23(29)31-3)27(26-19)15-9-7-6-8-10-15/h6-10,12-13H,4-5,11H2,1-3H3 |
| InChIKey | DUKBQBLKEPLCFB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.25 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|