C26H30N2O5 — CID 169387866
dimethyl 3-[2-(hexoxymethyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169387866) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is dimethyl 3-[2-(hexoxymethyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[2-(hexoxymethyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169387866 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | dimethyl 3-[2-(hexoxymethyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | CCCCCCOCc1ccccc1-c1nn(-c2ccccc2)c(C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C26H30N2O5/c1-4-5-6-12-17-33-18-19-13-10-11-16-21(19)23-22(25(29)31-2)24(26(30)32-3)28(27-23)20-14-8-7-9-15-20/h7-11,13-16H,4-6,12,17-18H2,1-3H3 |
| InChIKey | KBRMMLJCAJCLSP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|