C25H27FN2O5 — CID 169387928
dimethyl 3-[3-fluoro-4-(pentoxymethyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169387928) has the molecular formula C25H27FN2O5 and a molecular weight of 454.50 g/mol. Its IUPAC name is dimethyl 3-[3-fluoro-4-(pentoxymethyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[3-fluoro-4-(pentoxymethyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169387928 |
| Molecular Formula | C25H27FN2O5 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | dimethyl 3-[3-fluoro-4-(pentoxymethyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | CCCCCOCc1ccc(-c2nn(-c3ccccc3)c(C(=O)OC)c2C(=O)OC)cc1F |
| InChI | InChI=1S/C25H27FN2O5/c1-4-5-9-14-33-16-18-13-12-17(15-20(18)26)22-21(24(29)31-2)23(25(30)32-3)28(27-22)19-10-7-6-8-11-19/h6-8,10-13,15H,4-5,9,14,16H2,1-3H3 |
| InChIKey | FHFBIBPWUXPZGO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|