C23H24N2O4S — CID 169387834
dimethyl 3-(3-butylsulfanylphenyl)-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169387834) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is dimethyl 3-(3-butylsulfanylphenyl)-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(3-butylsulfanylphenyl)-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169387834 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | dimethyl 3-(3-butylsulfanylphenyl)-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | CCCCSc1cccc(-c2nn(-c3ccccc3)c(C(=O)OC)c2C(=O)OC)c1 |
| InChI | InChI=1S/C23H24N2O4S/c1-4-5-14-30-18-13-9-10-16(15-18)20-19(22(26)28-2)21(23(27)29-3)25(24-20)17-11-7-6-8-12-17/h6-13,15H,4-5,14H2,1-3H3 |
| InChIKey | SQCZSGTYQNATRF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|