C22H22N2O4S — CID 169387840
dimethyl 1-phenyl-3-(3-propylsulfanylphenyl)pyrazole-4,5-dicarboxylate (PubChem CID 169387840) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is dimethyl 1-phenyl-3-(3-propylsulfanylphenyl)pyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 1-phenyl-3-(3-propylsulfanylphenyl)pyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169387840 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | dimethyl 1-phenyl-3-(3-propylsulfanylphenyl)pyrazole-4,5-dicarboxylate |
| SMILES | CCCSc1cccc(-c2nn(-c3ccccc3)c(C(=O)OC)c2C(=O)OC)c1 |
| InChI | InChI=1S/C22H22N2O4S/c1-4-13-29-17-12-8-9-15(14-17)19-18(21(25)27-2)20(22(26)28-3)24(23-19)16-10-6-5-7-11-16/h5-12,14H,4,13H2,1-3H3 |
| InChIKey | ABTXGGAOXJQUIJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |