C26H19N3O4 — CID 169388401
dimethyl 3-[3-(2-cyanophenyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169388401) has the molecular formula C26H19N3O4 and a molecular weight of 437.46 g/mol. Its IUPAC name is dimethyl 3-[3-(2-cyanophenyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[3-(2-cyanophenyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169388401 |
| Molecular Formula | C26H19N3O4 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | dimethyl 3-[3-(2-cyanophenyl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2cccc(-c3ccccc3C#N)c2)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C26H19N3O4/c1-32-25(30)22-23(28-29(24(22)26(31)33-2)20-12-4-3-5-13-20)18-11-8-10-17(15-18)21-14-7-6-9-19(21)16-27/h3-15H,1-2H3 |
| InChIKey | JDEJUPOMRHITCE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 94.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |