C26H19N3O5 — CID 169387547
dimethyl 3-[3-(4-cyanophenoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169387547) has the molecular formula C26H19N3O5 and a molecular weight of 453.45 g/mol. Its IUPAC name is dimethyl 3-[3-(4-cyanophenoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[3-(4-cyanophenoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169387547 |
| Molecular Formula | C26H19N3O5 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | dimethyl 3-[3-(4-cyanophenoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2cccc(Oc3ccc(C#N)cc3)c2)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C26H19N3O5/c1-32-25(30)22-23(28-29(24(22)26(31)33-2)19-8-4-3-5-9-19)18-7-6-10-21(15-18)34-20-13-11-17(16-27)12-14-20/h3-15H,1-2H3 |
| InChIKey | JATNGMRIZYJWQC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 103.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |