C24H23N3O5 — CID 169389234
dimethyl 3-[4-(4-cyanobutoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169389234) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is dimethyl 3-[4-(4-cyanobutoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[4-(4-cyanobutoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169389234 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | dimethyl 3-[4-(4-cyanobutoxy)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2ccc(OCCCCC#N)cc2)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C24H23N3O5/c1-30-23(28)20-21(17-11-13-19(14-12-17)32-16-8-4-7-15-25)26-27(22(20)24(29)31-2)18-9-5-3-6-10-18/h3,5-6,9-14H,4,7-8,16H2,1-2H3 |
| InChIKey | JENYIHSEFLBDRN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 103.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|