C25H28N2O5 — CID 169387570
dimethyl 3-(4-hexoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169387570) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is dimethyl 3-(4-hexoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(4-hexoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169387570 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | dimethyl 3-(4-hexoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | CCCCCCOc1ccc(-c2nn(-c3ccccc3)c(C(=O)OC)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C25H28N2O5/c1-4-5-6-10-17-32-20-15-13-18(14-16-20)22-21(24(28)30-2)23(25(29)31-3)27(26-22)19-11-8-7-9-12-19/h7-9,11-16H,4-6,10,17H2,1-3H3 |
| InChIKey | MWQOTDNIVXMVPE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|