C24H25ClN2O5 — CID 169389024
dimethyl 3-(5-chloro-2-pentoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169389024) has the molecular formula C24H25ClN2O5 and a molecular weight of 456.93 g/mol. Its IUPAC name is dimethyl 3-(5-chloro-2-pentoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(5-chloro-2-pentoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169389024 |
| Molecular Formula | C24H25ClN2O5 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | dimethyl 3-(5-chloro-2-pentoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | CCCCCOc1ccc(Cl)cc1-c1nn(-c2ccccc2)c(C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C24H25ClN2O5/c1-4-5-9-14-32-19-13-12-16(25)15-18(19)21-20(23(28)30-2)22(24(29)31-3)27(26-21)17-10-7-6-8-11-17/h6-8,10-13,15H,4-5,9,14H2,1-3H3 |
| InChIKey | OZBIATGNANPSQX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|