C27H32N2O5 — CID 169387473
dimethyl 3-(4-octoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169387473) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is dimethyl 3-(4-octoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(4-octoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169387473 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | dimethyl 3-(4-octoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | CCCCCCCCOc1ccc(-c2nn(-c3ccccc3)c(C(=O)OC)c2C(=O)OC)cc1 |
| InChI | InChI=1S/C27H32N2O5/c1-4-5-6-7-8-12-19-34-22-17-15-20(16-18-22)24-23(26(30)32-2)25(27(31)33-3)29(28-24)21-13-10-9-11-14-21/h9-11,13-18H,4-8,12,19H2,1-3H3 |
| InChIKey | IQSJPABXOGPPED-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|