C20H15N3O4 — CID 169387271
dimethyl 3-(3-cyanophenyl)-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169387271) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is dimethyl 3-(3-cyanophenyl)-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(3-cyanophenyl)-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169387271 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | dimethyl 3-(3-cyanophenyl)-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2cccc(C#N)c2)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C20H15N3O4/c1-26-19(24)16-17(14-8-6-7-13(11-14)12-21)22-23(18(16)20(25)27-2)15-9-4-3-5-10-15/h3-11H,1-2H3 |
| InChIKey | CRILPLWWBPISNM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 94.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |