C23H20Br2N2O6 — CID 169389355
dimethyl 3-(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169389355) has the molecular formula C23H20Br2N2O6 and a molecular weight of 580.23 g/mol. Its IUPAC name is dimethyl 3-(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169389355 |
| Molecular Formula | C23H20Br2N2O6 |
| Molecular Weight | 580.23 g/mol |
| Exact Mass | 577.97 |
| IUPAC Name | dimethyl 3-(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | C=CCOc1c(OC)cc(-c2nn(-c3ccccc3)c(C(=O)OC)c2C(=O)OC)c(Br)c1Br |
| InChI | InChI=1S/C23H20Br2N2O6/c1-5-11-33-21-15(30-2)12-14(17(24)18(21)25)19-16(22(28)31-3)20(23(29)32-4)27(26-19)13-9-7-6-8-10-13/h5-10,12H,1,11H2,2-4H3 |
| InChIKey | CMIYZYHPDRMZLH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.23 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|