C24H20ClN5O7 — CID 169388302
dimethyl 3-[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169388302) has the molecular formula C24H20ClN5O7 and a molecular weight of 525.91 g/mol. Its IUPAC name is dimethyl 3-[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169388302 |
| Molecular Formula | C24H20ClN5O7 |
| Molecular Weight | 525.91 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | dimethyl 3-[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2ccc(OC)c(Cn3cc(Cl)c([N+](=O)[O-])n3)c2)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C24H20ClN5O7/c1-35-18-10-9-14(11-15(18)12-28-13-17(25)22(27-28)30(33)34)20-19(23(31)36-2)21(24(32)37-3)29(26-20)16-7-5-4-6-8-16/h4-11,13H,12H2,1-3H3 |
| InChIKey | QAPDGOUKYLTHSZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 140.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.91 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|