C19H15N3O6S — CID 7763644
ethyl 5-amino-4-cyano-3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]oxymethyl]thiophene-2-carboxylate (PubChem CID 7763644) has the molecular formula C19H15N3O6S and a molecular weight of 413.41 g/mol. Its IUPAC name is ethyl 5-amino-4-cyano-3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]oxymethyl]thiophene-2-carboxylate.
| Compound Name | ethyl 5-amino-4-cyano-3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]oxymethyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 7763644 |
| Molecular Formula | C19H15N3O6S |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | ethyl 5-amino-4-cyano-3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]oxymethyl]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(N)c(C#N)c1COC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H15N3O6S/c1-2-27-19(26)15-13(12(7-20)16(21)29-15)9-28-14(23)8-22-17(24)10-5-3-4-6-11(10)18(22)25/h3-6H,2,8-9,21H2,1H3 |
| InChIKey | JKFONZRGWXPBDZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|